Products 843621-75-0

CAS 843621-75-0 is the registry number for 2-[(7-Methyl-2-oxo-4-propyl-2h-chromen-5-yl)oxy]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(7-methyl-2-oxo-4-propylchromen-5-yl)oxypropanoic acid (CAS 843621-75-0) is a chemical compound with the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. IUPAC name: 2-(7-methyl-2-oxo-4-propylchromen-5-yl)oxypropanoic acid. InChIKey: ITYIGANVZLOJTB-UHFFFAOYSA-N.

Identity
Molecular formulaC16H18O5
Molecular weight290.31 g/mol
IUPAC name2-(7-methyl-2-oxo-4-propylchromen-5-yl)oxypropanoic acid
InChIKeyITYIGANVZLOJTB-UHFFFAOYSA-N
SMILESCCCC1=CC(=O)OC2=C1C(=CC(=C2)C)OC(C)C(=O)O

Computed by PubChem (NCBI)