Products 77652-69-8
CAS 77652-69-8 is the registry number for 7-Bromo-3-((hydroxyimino)methyl)-4H-chromen-4-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7-bromo-3-[(E)-hydroxyiminomethyl]chromen-4-one (CAS 77652-69-8) is a chemical compound with the molecular formula C10H6BrNO3 and a molecular weight of 268.06 g/mol. IUPAC name: 7-bromo-3-[(E)-hydroxyiminomethyl]chromen-4-one. InChIKey: SJAHBHUWLQRPNQ-UUILKARUSA-N.
| Molecular formula | C10H6BrNO3 |
|---|---|
| Molecular weight | 268.06 g/mol |
| IUPAC name | 7-bromo-3-[(E)-hydroxyiminomethyl]chromen-4-one |
| InChIKey | SJAHBHUWLQRPNQ-UUILKARUSA-N |
| SMILES | C1=CC2=C(C=C1Br)OC=C(C2=O)/C=N/O |
Computed by PubChem (NCBI)