Products 77718-46-8

CAS 77718-46-8 is the registry number for 3-(Aminocarbonyl)-4-hydroxybenzenesulfonyl chloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-carbamoyl-4-hydroxybenzenesulfonyl chloride (CAS 77718-46-8) is a chemical compound with the molecular formula C7H6ClNO4S and a molecular weight of 235.65 g/mol. IUPAC name: 3-carbamoyl-4-hydroxybenzenesulfonyl chloride. InChIKey: RJMAPSWKUKFBCF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6ClNO4S
Molecular weight235.65 g/mol
IUPAC name3-carbamoyl-4-hydroxybenzenesulfonyl chloride
InChIKeyRJMAPSWKUKFBCF-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1S(=O)(=O)Cl)C(=O)N)O

Computed by PubChem (NCBI)