Products 77727-88-9
CAS 77727-88-9 is the registry number for 3-(Pyrrolidine-1-carbonyl)pyridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
Pyridin-3-yl(pyrrolidin-1-yl)methanone (CAS 77727-88-9) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: pyridin-3-yl(pyrrolidin-1-yl)methanone. InChIKey: UVTAMWNTYFEONL-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | pyridin-3-yl(pyrrolidin-1-yl)methanone |
| InChIKey | UVTAMWNTYFEONL-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C2=CN=CC=C2 |
Computed by PubChem (NCBI)