Products 777877-45-9
CAS 777877-45-9 appears in our catalog under these names: 2-(Butyrylamino)-4-chlorobenzoic acid, 95%, 2-Butyramido-4-chlorobenzoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(butanoylamino)-4-chlorobenzoic acid (CAS 777877-45-9) is a chemical compound with the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. IUPAC name: 2-(butanoylamino)-4-chlorobenzoic acid. InChIKey: OYDAXENJTPWLSC-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO3 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | 2-(butanoylamino)-4-chlorobenzoic acid |
| InChIKey | OYDAXENJTPWLSC-UHFFFAOYSA-N |
| SMILES | CCCC(=O)NC1=C(C=CC(=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)