CAS 77859-33-7 appears in our catalog under these names: 4-Phenoxy-1,3-benzothiazol-2-amine, 95%, 4-Phenoxy-1,3-benzothiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-phenoxy-1,3-benzothiazol-2-amine (CAS 77859-33-7) is a chemical compound with the molecular formula C13H10N2OS and a molecular weight of 242.30 g/mol. IUPAC name: 4-phenoxy-1,3-benzothiazol-2-amine. InChIKey: SLROQLPSKILYLU-UHFFFAOYSA-N.
| Molecular formula | C13H10N2OS |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 4-phenoxy-1,3-benzothiazol-2-amine |
| InChIKey | SLROQLPSKILYLU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C3C(=CC=C2)SC(=N3)N |
Computed by PubChem (NCBI)