Products 77963-70-3
CAS 77963-70-3 is the registry number for RU 27849. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,3,4,5-tetrahydrobenzo[cd]indol-4-amine (CAS 77963-70-3) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. IUPAC name: 1,3,4,5-tetrahydrobenzo[cd]indol-4-amine. InChIKey: JPTWSZJFCLJZJX-UHFFFAOYSA-N.
| Molecular formula | C11H12N2 |
|---|---|
| Molecular weight | 172.23 g/mol |
| IUPAC name | 1,3,4,5-tetrahydrobenzo[cd]indol-4-amine |
| InChIKey | JPTWSZJFCLJZJX-UHFFFAOYSA-N |
| SMILES | C1C(CC2=CNC3=CC=CC1=C23)N |
Computed by PubChem (NCBI)