CAS 78074-39-2 is the registry number for Stiripentol Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,3-benzodioxol-5-yl)-4,4-dimethylpentan-3-one (CAS 78074-39-2) is a chemical compound with the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-4,4-dimethylpentan-3-one. InChIKey: KLZCQGAOCOTZLW-UHFFFAOYSA-N.
| Molecular formula | C14H18O3 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-4,4-dimethylpentan-3-one |
| InChIKey | KLZCQGAOCOTZLW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CCC1=CC2=C(C=C1)OCO2 |
Computed by PubChem (NCBI)