Products 78208-69-2
CAS 78208-69-2 appears in our catalog under these names: Methyl 1,3-dimethyl-4-nitro-1H-pyrazole-5-carboxylate, 95%, Methyl 1,3-dimethyl-4-nitro-1H-pyrazole-5-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 1,3-dimethyl-4-nitropyrazole-5-carboxylate (CAS 78208-69-2) is a chemical compound with the molecular formula C7H9N3O4 and a molecular weight of 199.16 g/mol. IUPAC name: methyl 1,3-dimethyl-4-nitropyrazole-5-carboxylate. InChIKey: IOUAFFJKVPAOLG-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O4 |
|---|---|
| Molecular weight | 199.16 g/mol |
| IUPAC name | methyl 1,3-dimethyl-4-nitropyrazole-5-carboxylate |
| InChIKey | IOUAFFJKVPAOLG-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1[N+](=O)[O-])C(=O)OC)C |
Computed by PubChem (NCBI)