Products 78225-54-4
CAS 78225-54-4 is the registry number for Didechloropyoluteorin. Offered by: TRC. Available pack sizes: 100mg.
(2,6-dihydroxyphenyl)-(1H-pyrrol-2-yl)methanone (CAS 78225-54-4) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: (2,6-dihydroxyphenyl)-(1H-pyrrol-2-yl)methanone. InChIKey: AHAUQCJBMMUQMB-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | (2,6-dihydroxyphenyl)-(1H-pyrrol-2-yl)methanone |
| InChIKey | AHAUQCJBMMUQMB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)C(=O)C2=CC=CN2)O |
Computed by PubChem (NCBI)