CAS 78277-27-7 is the registry number for Benzyl 1H-indole-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl 1H-indole-2-carboxylate (CAS 78277-27-7) is a chemical compound with the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. IUPAC name: benzyl 1H-indole-2-carboxylate. InChIKey: GBVAGZMJJSANDQ-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | benzyl 1H-indole-2-carboxylate |
| InChIKey | GBVAGZMJJSANDQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)