CAS 78339-57-8 appears in our catalog under these names: Z–D–Pyr–OH, Z-D-Pyr-OH, Cbz-D-Pyr-OH, 98%, Z-D-Pyr-OH, 98%, (R)-1-((Benzyloxy)carbonyl)-5-oxopyrrolidine-2-carboxylic acid, 98%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, BLDpharm. Available pack sizes: 25g, 5g, 100g, 1g.
(2R)-5-oxo-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid (CAS 78339-57-8) is a chemical compound with the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. IUPAC name: (2R)-5-oxo-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid. InChIKey: VHSFUGXCSGOKJX-SNVBAGLBSA-N.
| Molecular formula | C13H13NO5 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | (2R)-5-oxo-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| InChIKey | VHSFUGXCSGOKJX-SNVBAGLBSA-N |
| SMILES | C1CC(=O)N([C@H]1C(=O)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)