CAS 784203-75-4 is the registry number for 6–CHLORO–4–METHYL–1(2H)–PHTHALAZINONE. Offered by: GLPBio. Available pack sizes: 100mg.
6-chloro-4-methyl-2H-phthalazin-1-one (CAS 784203-75-4) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 6-chloro-4-methyl-2H-phthalazin-1-one. InChIKey: UNIGVHVDXCLPTB-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 6-chloro-4-methyl-2H-phthalazin-1-one |
| InChIKey | UNIGVHVDXCLPTB-UHFFFAOYSA-N |
| SMILES | CC1=NNC(=O)C2=C1C=C(C=C2)Cl |
Computed by PubChem (NCBI)