CAS 78533-94-5 appears in our catalog under these names: 2-Phenylpropane-1,3-diamine dihydrochloride, 95%, 2-Phenylpropane-1,3-diamine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-phenylpropane-1,3-diamine;dihydrochloride (CAS 78533-94-5) is a chemical compound with the molecular formula C9H16Cl2N2 and a molecular weight of 223.14 g/mol. IUPAC name: 2-phenylpropane-1,3-diamine;dihydrochloride. InChIKey: WZRYMESFXWYIND-UHFFFAOYSA-N.
| Molecular formula | C9H16Cl2N2 |
|---|---|
| Molecular weight | 223.14 g/mol |
| IUPAC name | 2-phenylpropane-1,3-diamine;dihydrochloride |
| InChIKey | WZRYMESFXWYIND-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CN)CN.Cl.Cl |
Computed by PubChem (NCBI)