Products 78583-88-7
CAS 78583-88-7 is the registry number for 3-Chloro-3-(4-nitrophenyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-chloro-3-(4-nitrophenyl)prop-2-enenitrile (CAS 78583-88-7) is a chemical compound with the molecular formula C9H5ClN2O2 and a molecular weight of 208.60 g/mol. IUPAC name: 3-chloro-3-(4-nitrophenyl)prop-2-enenitrile. InChIKey: PWJDADFQYZTUAQ-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O2 |
|---|---|
| Molecular weight | 208.60 g/mol |
| IUPAC name | 3-chloro-3-(4-nitrophenyl)prop-2-enenitrile |
| InChIKey | PWJDADFQYZTUAQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=CC#N)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)