Products 78641-39-1

CAS 78641-39-1 is the registry number for Latamoxef Impurity 34. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(4-methoxyphenyl)methyl 2-(4-hydroxyphenyl)acetate (CAS 78641-39-1) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: (4-methoxyphenyl)methyl 2-(4-hydroxyphenyl)acetate. InChIKey: BRVVSYVRJCUOGD-UHFFFAOYSA-N.

Identity
Molecular formulaC16H16O4
Molecular weight272.29 g/mol
IUPAC name(4-methoxyphenyl)methyl 2-(4-hydroxyphenyl)acetate
InChIKeyBRVVSYVRJCUOGD-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)COC(=O)CC2=CC=C(C=C2)O

Computed by PubChem (NCBI)