CAS 786657-15-6 appears in our catalog under these names: 1–(9H–Fluoren–9–yl)–2,2–dimethylpropan–1–one, 1-(9H-Fluoren-9-yl)-2,2-dimethylpropan-1-one, 95%, 95%, 1-(9H-FLUOREN-9-YL)-2,2-DIMETHYLPROPAN-1-ONE, 99%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(9H-fluoren-9-yl)-2,2-dimethylpropan-1-one (CAS 786657-15-6) is a chemical compound with the molecular formula C18H18O and a molecular weight of 250.3 g/mol. IUPAC name: 1-(9H-fluoren-9-yl)-2,2-dimethylpropan-1-one. InChIKey: NAUVQRYTDICSRY-UHFFFAOYSA-N.
| Molecular formula | C18H18O |
|---|---|
| Molecular weight | 250.3 g/mol |
| IUPAC name | 1-(9H-fluoren-9-yl)-2,2-dimethylpropan-1-one |
| InChIKey | NAUVQRYTDICSRY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)