CAS 786685-86-7 appears in our catalog under these names: 4-(4-Fluorophenyl)-2-fluorobenzoic acid, 97%, 4-(4-Fluorophenyl)-2-fluorobenzoic acid, 4-(4-Fluorophenyl)-2-fluorobenzoic acid, 97%, 97%, 3,4'-Difluoro-[1,1'-biphenyl]-4-carboxylic acid, 95%, 3,4'-Difluoro-[1,1'-biphenyl]-4-carboxylic acid, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
2-fluoro-4-(4-fluorophenyl)benzoic acid (CAS 786685-86-7) is a chemical compound with the molecular formula C13H8F2O2 and a molecular weight of 234.20 g/mol. IUPAC name: 2-fluoro-4-(4-fluorophenyl)benzoic acid. InChIKey: VHYXMXAOCUVYFJ-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O2 |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 2-fluoro-4-(4-fluorophenyl)benzoic acid |
| InChIKey | VHYXMXAOCUVYFJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)C(=O)O)F)F |
Computed by PubChem (NCBI)