Products 78726-75-7
CAS 78726-75-7 appears in our catalog under these names: 3-Methyl-4-nitrobenzene-1-sulfonyl chloride, 97%, 3-methyl-4-nitrobenzenesulfonyl chloride, 97%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g.
3-methyl-4-nitrobenzenesulfonyl chloride (CAS 78726-75-7) is a chemical compound with the molecular formula C7H6ClNO4S and a molecular weight of 235.65 g/mol. IUPAC name: 3-methyl-4-nitrobenzenesulfonyl chloride. InChIKey: BSTFFQWSGXDOOL-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO4S |
|---|---|
| Molecular weight | 235.65 g/mol |
| IUPAC name | 3-methyl-4-nitrobenzenesulfonyl chloride |
| InChIKey | BSTFFQWSGXDOOL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)S(=O)(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)