CAS 78863-98-6 is the registry number for 5-Bromo-1,2,3,4-tetrahydrocarbazole. Offered by: TRC. Available pack sizes: 1g.
5-bromo-2,3,4,9-tetrahydro-1H-carbazole (CAS 78863-98-6) is a chemical compound with the molecular formula C12H12BrN and a molecular weight of 250.13 g/mol. IUPAC name: 5-bromo-2,3,4,9-tetrahydro-1H-carbazole. InChIKey: ZOMBRBLFIFOTGG-UHFFFAOYSA-N.
| Molecular formula | C12H12BrN |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | 5-bromo-2,3,4,9-tetrahydro-1H-carbazole |
| InChIKey | ZOMBRBLFIFOTGG-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(N2)C=CC=C3Br |
Computed by PubChem (NCBI)