CAS 78892-45-2 appears in our catalog under these names: 4-((2,6-Dimethylphenyl)methyl)-1H-imidazole hydrochloride, 95%, 4-((2,6-Dimethylphenyl)methyl)-1H-imidazole hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-[(2,6-dimethylphenyl)methyl]-1H-imidazole;hydrochloride (CAS 78892-45-2) is a chemical compound with the molecular formula C12H15ClN2 and a molecular weight of 222.71 g/mol. IUPAC name: 5-[(2,6-dimethylphenyl)methyl]-1H-imidazole;hydrochloride. InChIKey: HRPJDEUIMHHMEL-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2 |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | 5-[(2,6-dimethylphenyl)methyl]-1H-imidazole;hydrochloride |
| InChIKey | HRPJDEUIMHHMEL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)CC2=CN=CN2.Cl |
Computed by PubChem (NCBI)