Products 78945-99-0
CAS 78945-99-0 is the registry number for 1-Oxo-4-phenyl-1,2-dihydroisoquinoline-3-carboxylic acid 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-oxo-4-phenyl-2H-isoquinoline-3-carboxylic acid (CAS 78945-99-0) is a chemical compound with the molecular formula C16H11NO3 and a molecular weight of 265.26 g/mol. IUPAC name: 1-oxo-4-phenyl-2H-isoquinoline-3-carboxylic acid. InChIKey: QHGFXFOHCVKALF-UHFFFAOYSA-N.
| Molecular formula | C16H11NO3 |
|---|---|
| Molecular weight | 265.26 g/mol |
| IUPAC name | 1-oxo-4-phenyl-2H-isoquinoline-3-carboxylic acid |
| InChIKey | QHGFXFOHCVKALF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(NC(=O)C3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)