Products 78995-74-1

CAS 78995-74-1 is the registry number for (+)-3,4-Dihydroxy-α-[[(1-methylethyl)amino]methyl]benzenemethanesulfonic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

1-(3,4-dihydroxyphenyl)-2-(propan-2-ylamino)ethanesulfonic acid (CAS 78995-74-1) is a chemical compound with the molecular formula C11H17NO5S and a molecular weight of 275.32 g/mol. IUPAC name: 1-(3,4-dihydroxyphenyl)-2-(propan-2-ylamino)ethanesulfonic acid. InChIKey: ZWPAWKMYYCYQQM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17NO5S
Molecular weight275.32 g/mol
IUPAC name1-(3,4-dihydroxyphenyl)-2-(propan-2-ylamino)ethanesulfonic acid
InChIKeyZWPAWKMYYCYQQM-UHFFFAOYSA-N
SMILESCC(C)NCC(C1=CC(=C(C=C1)O)O)S(=O)(=O)O

Computed by PubChem (NCBI)