CAS 790271-06-6 appears in our catalog under these names: 2-Bromo-5-(ethylsulfamoyl)benzoic acid, 95%, 2-Bromo-5-(ethylsulfamoyl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-bromo-5-(ethylsulfamoyl)benzoic acid (CAS 790271-06-6) is a chemical compound with the molecular formula C9H10BrNO4S and a molecular weight of 308.15 g/mol. IUPAC name: 2-bromo-5-(ethylsulfamoyl)benzoic acid. InChIKey: NWFCKUNKCMNENA-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO4S |
|---|---|
| Molecular weight | 308.15 g/mol |
| IUPAC name | 2-bromo-5-(ethylsulfamoyl)benzoic acid |
| InChIKey | NWFCKUNKCMNENA-UHFFFAOYSA-N |
| SMILES | CCNS(=O)(=O)C1=CC(=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)