Products 790681-74-2
CAS 790681-74-2 appears in our catalog under these names: 3-(5,6,7,8-Tetrahydronaphthalene-2-sulfonamido)propanoic acid, 3-(5,6,7,8-Tetrahydronaphthalene-2-sulfonamido)propanoic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 0,5g, 1g, 100mg, 250mg, 10g.
3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)propanoic acid (CAS 790681-74-2) is a chemical compound with the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. IUPAC name: 3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)propanoic acid. InChIKey: WGVHAEJKQUYTQJ-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4S |
|---|---|
| Molecular weight | 283.35 g/mol |
| IUPAC name | 3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)propanoic acid |
| InChIKey | WGVHAEJKQUYTQJ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=CC(=C2)S(=O)(=O)NCCC(=O)O |
Computed by PubChem (NCBI)