Products 794461-69-1
CAS 794461-69-1 is the registry number for [2-(ETHOXYCARBONYL)PYRIDIN-4-YL]BORONIC ACID, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2-ethoxycarbonyl-4-pyridinyl)boronic acid (CAS 794461-69-1) is a chemical compound with the molecular formula C8H10BNO4 and a molecular weight of 194.98 g/mol. IUPAC name: (2-ethoxycarbonyl-4-pyridinyl)boronic acid. InChIKey: RUURJSHMPFVDQC-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO4 |
|---|---|
| Molecular weight | 194.98 g/mol |
| IUPAC name | (2-ethoxycarbonyl-4-pyridinyl)boronic acid |
| InChIKey | RUURJSHMPFVDQC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC=C1)C(=O)OCC)(O)O |
Computed by PubChem (NCBI)