Products 796108-95-7
CAS 796108-95-7 is the registry number for Firefly luciferase-IN-2, 90.0%. Offered by: MedChemExpress. Available pack sizes: 1 mg.
5-(2-chloro-4-methylphenyl)-3-phenyl-1,2,4-oxadiazole (CAS 796108-95-7) is a chemical compound with the molecular formula C15H11ClN2O and a molecular weight of 270.71 g/mol. IUPAC name: 5-(2-chloro-4-methylphenyl)-3-phenyl-1,2,4-oxadiazole. InChIKey: VKXJIEMSZDBZKJ-UHFFFAOYSA-N.
| Molecular formula | C15H11ClN2O |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | 5-(2-chloro-4-methylphenyl)-3-phenyl-1,2,4-oxadiazole |
| InChIKey | VKXJIEMSZDBZKJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=NC(=NO2)C3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)