CAS 79780-61-3 appears in our catalog under these names: 2,3-Diaminoterephthalonitrile 97%, 2,3-Diaminoterephthalonitrile, 97%, 97%, 2,3-Diaminoterephthalonitrile, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,3-diaminobenzene-1,4-dicarbonitrile (CAS 79780-61-3) is a chemical compound with the molecular formula C8H6N4 and a molecular weight of 158.16 g/mol. IUPAC name: 2,3-diaminobenzene-1,4-dicarbonitrile. InChIKey: ZRMXARGXRHLBDO-UHFFFAOYSA-N.
| Molecular formula | C8H6N4 |
|---|---|
| Molecular weight | 158.16 g/mol |
| IUPAC name | 2,3-diaminobenzene-1,4-dicarbonitrile |
| InChIKey | ZRMXARGXRHLBDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C#N)N)N)C#N |
Computed by PubChem (NCBI)