Products 79807-38-8
CAS 79807-38-8 is the registry number for Ethyl 4,5-dichloro-1,3-thiazole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,25g, 0,1g, 0,5g, 1g, 2g.
Ethyl 4,5-dichloro-1,3-thiazole-2-carboxylate (CAS 79807-38-8) is a chemical compound with the molecular formula C6H5Cl2NO2S and a molecular weight of 226.08 g/mol. IUPAC name: ethyl 4,5-dichloro-1,3-thiazole-2-carboxylate. InChIKey: NGZQHWGVYVNKKC-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO2S |
|---|---|
| Molecular weight | 226.08 g/mol |
| IUPAC name | ethyl 4,5-dichloro-1,3-thiazole-2-carboxylate |
| InChIKey | NGZQHWGVYVNKKC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=C(S1)Cl)Cl |
Computed by PubChem (NCBI)