CAS 79815-18-2 appears in our catalog under these names: (S)-Methyl 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate, 95%, 95%, (S)-Methyl 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 100mg, 250mg, 1g.
Methyl (3S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate (CAS 79815-18-2) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: methyl (3S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate. InChIKey: QZGCHMZBGHVZFB-NSHDSACASA-N.
| Molecular formula | C13H14N2O2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | methyl (3S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
| InChIKey | QZGCHMZBGHVZFB-NSHDSACASA-N |
| SMILES | COC(=O)[C@@H]1CC2=C(CN1)NC3=CC=CC=C23 |
Computed by PubChem (NCBI)