CAS 798563-50-5 appears in our catalog under these names: 2–(2–Fluoro–5–methoxyphenyl)acetic acid, 2-(2-Fluoro-5-methoxyphenyl)acetic acid, 2-(2-Fluoro-5-methoxyphenyl),acetic acid, 98%, 98%, 2-(2-Fluoro-5-methoxyphenyl)acetic acid, 98%, 2-(2-Fluoro-5-methoxyphenyl)acetic acid, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-(2-fluoro-5-methoxyphenyl)acetic acid (CAS 798563-50-5) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: 2-(2-fluoro-5-methoxyphenyl)acetic acid. InChIKey: FQQPGAGVFVTCDB-UHFFFAOYSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | 2-(2-fluoro-5-methoxyphenyl)acetic acid |
| InChIKey | FQQPGAGVFVTCDB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)F)CC(=O)O |
Computed by PubChem (NCBI)