Products 80035-52-5

CAS 80035-52-5 is the registry number for Methyl 2,4-dioxo-6-phenylcyclohexanecarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2,4-dioxo-6-phenylcyclohexane-1-carboxylate (CAS 80035-52-5) is a chemical compound with the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. IUPAC name: methyl 2,4-dioxo-6-phenylcyclohexane-1-carboxylate. InChIKey: AUZLBHFNOOBPJL-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14O4
Molecular weight246.26 g/mol
IUPAC namemethyl 2,4-dioxo-6-phenylcyclohexane-1-carboxylate
InChIKeyAUZLBHFNOOBPJL-UHFFFAOYSA-N
SMILESCOC(=O)C1C(CC(=O)CC1=O)C2=CC=CC=C2

Computed by PubChem (NCBI)