CAS 80195-31-9 is the registry number for 3,6-Dimethyl-2-sulfanyl-3,4-dihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3,6-dimethyl-2-sulfanylidene-1H-quinazolin-4-one (CAS 80195-31-9) is a chemical compound with the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. IUPAC name: 3,6-dimethyl-2-sulfanylidene-1H-quinazolin-4-one. InChIKey: FVXUYCAQINXRCR-UHFFFAOYSA-N.
| Molecular formula | C10H10N2OS |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | 3,6-dimethyl-2-sulfanylidene-1H-quinazolin-4-one |
| InChIKey | FVXUYCAQINXRCR-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC(=S)N(C2=O)C |
Computed by PubChem (NCBI)