Products 80386-99-8
CAS 80386-99-8 appears in our catalog under these names: 8-Methoxy-d3 Psoralen, >95% (HPLC), Methoxsalen-d3, 99.93%. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 50mg, 5mg, 1 mg.
9-(trideuteriomethoxy)furo[3,2-g]chromen-7-one (CAS 80386-99-8) is a chemical compound with the molecular formula C12H8O4 and a molecular weight of 219.21 g/mol. IUPAC name: 9-(trideuteriomethoxy)furo[3,2-g]chromen-7-one. InChIKey: QXKHYNVANLEOEG-FIBGUPNXSA-N.
| Molecular formula | C12H8O4 |
|---|---|
| Molecular weight | 219.21 g/mol |
| IUPAC name | 9-(trideuteriomethoxy)furo[3,2-g]chromen-7-one |
| InChIKey | QXKHYNVANLEOEG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C2C(=CC3=C1OC=C3)C=CC(=O)O2 |
Computed by PubChem (NCBI)