CAS 80418-12-8 appears in our catalog under these names: (R)–1–(4–Bromophenyl)–2,2,2–trifluoroethanol, (R)-1-(4-Bromophenyl)-2,2,2-trifluoroethanol 98%, (R)-1-(4-Bromophenyl)-2,2,2-trifluoroethanol, 98%, 98%, (R)-1-(4-Bromophenyl)-2,2,2-trifluoroethan-1-ol, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 25g, 1g, 5g, 10g, 100mg.
(1R)-1-(4-bromophenyl)-2,2,2-trifluoroethanol (CAS 80418-12-8) is a chemical compound with the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. IUPAC name: (1R)-1-(4-bromophenyl)-2,2,2-trifluoroethanol. InChIKey: PHWPRSZULISLMK-SSDOTTSWSA-N.
| Molecular formula | C8H6BrF3O |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | (1R)-1-(4-bromophenyl)-2,2,2-trifluoroethanol |
| InChIKey | PHWPRSZULISLMK-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(F)(F)F)O)Br |
Computed by PubChem (NCBI)