CAS 80418-13-9 appears in our catalog under these names: (αS)–4–Bromo–α–(trifluoromethyl)benzenemethanol, (S)-1-(4-Bromophenyl)-2,2,2-trifluoroethanol, (S)-1-(4-Bromophenyl)-2,2,2-trifluoroethanol 98%, (S)-1-(4-Bromophenyl)-2,2,2-trifluoroethanol, 98%, 98%, (S)-1-(4-BROMOPHENYL)-2,2,2-TRIFLUOROETHANOL, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100g, 100mg, 25g, 10g.
(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanol (CAS 80418-13-9) is a chemical compound with the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. IUPAC name: (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanol. InChIKey: PHWPRSZULISLMK-ZETCQYMHSA-N.
| Molecular formula | C8H6BrF3O |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanol |
| InChIKey | PHWPRSZULISLMK-ZETCQYMHSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](C(F)(F)F)O)Br |
Computed by PubChem (NCBI)