Products 805247-72-7
CAS 805247-72-7 is the registry number for 1-(tert-Butyl) 2-ethyl (2S,3S)-3-hydroxypiperidine-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 2-O-ethyl (2S,3S)-3-hydroxypiperidine-1,2-dicarboxylate (CAS 805247-72-7) is a chemical compound with the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl (2S,3S)-3-hydroxypiperidine-1,2-dicarboxylate. InChIKey: ONDKIQFKYPHHOG-UWVGGRQHSA-N.
| Molecular formula | C13H23NO5 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl (2S,3S)-3-hydroxypiperidine-1,2-dicarboxylate |
| InChIKey | ONDKIQFKYPHHOG-UWVGGRQHSA-N |
| SMILES | CCOC(=O)[C@@H]1[C@H](CCCN1C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)