CAS 807283-74-5 appears in our catalog under these names: 3-((Methylamino)methyl)-2H-benzo(e)(1,2,4)thiadiazine 1,1-dioxide, 97%, N-​Methyl-2H-​1,​2,​4-​benzothiadiazine-​3-​methanamine 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)-N-methylmethanamine (CAS 807283-74-5) is a chemical compound with the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. IUPAC name: 1-(1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)-N-methylmethanamine. InChIKey: MIYWZRKAJSDVTK-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O2S |
|---|---|
| Molecular weight | 225.27 g/mol |
| IUPAC name | 1-(1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)-N-methylmethanamine |
| InChIKey | MIYWZRKAJSDVTK-UHFFFAOYSA-N |
| SMILES | CNCC1=NS(=O)(=O)C2=CC=CC=C2N1 |
Computed by PubChem (NCBI)