CAS 807382-47-4 appears in our catalog under these names: 4-(1-(Methoxycarbonyl)cyclopropyl)benzoic Acid, 4-(1-(Methoxycarbonyl)cyclopropyl)benzoic acid, 97%. Offered by: TRC, AmBeed. Available pack sizes: 250mg, 5g, 1g.
4-(1-methoxycarbonylcyclopropyl)benzoic acid (CAS 807382-47-4) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: 4-(1-methoxycarbonylcyclopropyl)benzoic acid. InChIKey: GMOUXACCXBMBMS-UHFFFAOYSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 4-(1-methoxycarbonylcyclopropyl)benzoic acid |
| InChIKey | GMOUXACCXBMBMS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CC1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)