CAS 81055-73-4 is the registry number for Ethyl 2,6-dichlorobenzoate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Ethyl 2,6-dichlorobenzoate (CAS 81055-73-4) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: ethyl 2,6-dichlorobenzoate. InChIKey: HAFAMHIZRCDTSS-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | ethyl 2,6-dichlorobenzoate |
| InChIKey | HAFAMHIZRCDTSS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC=C1Cl)Cl |
Computed by PubChem (NCBI)