Products 81066-45-7
CAS 81066-45-7 appears in our catalog under these names: Kauniolide, Kauniolide, 99.86%, Kauniolide, ≥98%. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 1 mg, 5 mg.
(3aS,9aS,9bS)-6,9-dimethyl-3-methylidene-3a,4,5,7,9a,9b-hexahydroazuleno[4,5-b]furan-2-one (CAS 81066-45-7) is a chemical compound with the molecular formula C15H18O2 and a molecular weight of 230.30 g/mol. IUPAC name: (3aS,9aS,9bS)-6,9-dimethyl-3-methylidene-3a,4,5,7,9a,9b-hexahydroazuleno[4,5-b]furan-2-one. InChIKey: AVLOGKPJWQCTLP-IHRRRGAJSA-N.
| Molecular formula | C15H18O2 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | (3aS,9aS,9bS)-6,9-dimethyl-3-methylidene-3a,4,5,7,9a,9b-hexahydroazuleno[4,5-b]furan-2-one |
| InChIKey | AVLOGKPJWQCTLP-IHRRRGAJSA-N |
| SMILES | CC1=C2CC=C([C@@H]2[C@@H]3[C@@H](CC1)C(=C)C(=O)O3)C |
Computed by PubChem (NCBI)
Synonyms:
Kauniolide, orb1706157