CAS 81114-41-2 is the registry number for 1–(Phenylsulfonyl)indoline. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
1-(benzenesulfonyl)-2,3-dihydroindole (CAS 81114-41-2) is a chemical compound with the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. IUPAC name: 1-(benzenesulfonyl)-2,3-dihydroindole. InChIKey: AVIIJCYFOVAPRK-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2S |
|---|---|
| Molecular weight | 259.33 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-2,3-dihydroindole |
| InChIKey | AVIIJCYFOVAPRK-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)S(=O)(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)