Products 81201-90-3
CAS 81201-90-3 appears in our catalog under these names: L–Tyrosine–4–13C, L-Tyrosine-4-13C, 99%, 99%, L-Tyrosine-4-13C, 99.80%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10 mg, 5 mg, 25 mg, 50 mg, 100 mg.
(2S)-2-amino-3-(4-hydroxy(413C)cyclohexa-1,3,5-trien-1-yl)propanoic acid (CAS 81201-90-3) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 182.18 g/mol. IUPAC name: (2S)-2-amino-3-(4-hydroxy(413C)cyclohexa-1,3,5-trien-1-yl)propanoic acid. InChIKey: OUYCCCASQSFEME-VGFAOSRESA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-hydroxy(413C)cyclohexa-1,3,5-trien-1-yl)propanoic acid |
| InChIKey | OUYCCCASQSFEME-VGFAOSRESA-N |
| SMILES | C1=C[13C](=CC=C1C[C@@H](C(=O)O)N)O |
Computed by PubChem (NCBI)