Products 81258-19-7
CAS 81258-19-7 is the registry number for 6-Bromo-8-chlorochromane, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-bromo-8-chloro-3,4-dihydro-2H-chromene (CAS 81258-19-7) is a chemical compound with the molecular formula C9H8BrClO and a molecular weight of 247.51 g/mol. IUPAC name: 6-bromo-8-chloro-3,4-dihydro-2H-chromene. InChIKey: AFFAGOSZFYMTID-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO |
|---|---|
| Molecular weight | 247.51 g/mol |
| IUPAC name | 6-bromo-8-chloro-3,4-dihydro-2H-chromene |
| InChIKey | AFFAGOSZFYMTID-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC(=C2)Br)Cl)OC1 |
Computed by PubChem (NCBI)