CAS 81329-74-0 appears in our catalog under these names: 3-[2-(Methoxycarbonyl)phenyl]propanoic acid, 95%, 3–(2–(Methoxycarbonyl)phenyl)propanoic acid, 3-(2-(methoxycarbonyl)phenyl)propanoic acid, 2-(Methoxycarbonyl)benzenepropanoic acid, 95%, 95%, 3-(2-(METHOXYCARBONYL)PHENYL)PROPANOIC ACID, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 2,5g, 5g.
3-(2-methoxycarbonylphenyl)propanoic acid (CAS 81329-74-0) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 3-(2-methoxycarbonylphenyl)propanoic acid. InChIKey: RRQCXVACIPBWHE-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 3-(2-methoxycarbonylphenyl)propanoic acid |
| InChIKey | RRQCXVACIPBWHE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC=C1CCC(=O)O |
Computed by PubChem (NCBI)