Products 81387-53-3
CAS 81387-53-3 appears in our catalog under these names: DL-3-Phenylalanine-15N, DL–Phenylalanine–15N. Offered by: MedChemExpress, GLPBio. Available pack sizes: 5mg, 1mg, 100mg.
2-(15N)azanyl-3-phenylpropanoic acid (CAS 81387-53-3) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 166.18 g/mol. IUPAC name: 2-(15N)azanyl-3-phenylpropanoic acid. InChIKey: COLNVLDHVKWLRT-DETAZLGJSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 2-(15N)azanyl-3-phenylpropanoic acid |
| InChIKey | COLNVLDHVKWLRT-DETAZLGJSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)[15NH2] |
Computed by PubChem (NCBI)