CAS 81447-78-1 is the registry number for (R)-Lofexidine, >95% (HPLC). Offered by: TRC. Available pack sizes: 1mg, 25mg, 5mg.
2-[(1R)-1-(2,6-dichlorophenoxy)ethyl]-4,5-dihydro-1H-imidazole (CAS 81447-78-1) is a chemical compound with the molecular formula C11H12Cl2N2O and a molecular weight of 259.13 g/mol. IUPAC name: 2-[(1R)-1-(2,6-dichlorophenoxy)ethyl]-4,5-dihydro-1H-imidazole. InChIKey: KSMAGQUYOIHWFS-SSDOTTSWSA-N.
| Molecular formula | C11H12Cl2N2O |
|---|---|
| Molecular weight | 259.13 g/mol |
| IUPAC name | 2-[(1R)-1-(2,6-dichlorophenoxy)ethyl]-4,5-dihydro-1H-imidazole |
| InChIKey | KSMAGQUYOIHWFS-SSDOTTSWSA-N |
| SMILES | C[C@H](C1=NCCN1)OC2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)