CAS 1240587-85-2 is the registry number for (S)-3-(3,4-Dichlorobenzyl)piperazin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-3-[(3,4-dichlorophenyl)methyl]piperazin-2-one (CAS 1240587-85-2) is a chemical compound with the molecular formula C11H12Cl2N2O and a molecular weight of 259.13 g/mol. IUPAC name: (3S)-3-[(3,4-dichlorophenyl)methyl]piperazin-2-one. InChIKey: MDATXSCGEUTITQ-JTQLQIEISA-N.
| Molecular formula | C11H12Cl2N2O |
|---|---|
| Molecular weight | 259.13 g/mol |
| IUPAC name | (3S)-3-[(3,4-dichlorophenyl)methyl]piperazin-2-one |
| InChIKey | MDATXSCGEUTITQ-JTQLQIEISA-N |
| SMILES | C1CNC(=O)[C@@H](N1)CC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)