CAS 923675-90-5 is the registry number for N-Cyclopropyl-2-((3,5-dichlorophenyl)amino)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-cyclopropyl-2-(3,5-dichloroanilino)acetamide (CAS 923675-90-5) is a chemical compound with the molecular formula C11H12Cl2N2O and a molecular weight of 259.13 g/mol. IUPAC name: N-cyclopropyl-2-(3,5-dichloroanilino)acetamide. InChIKey: OHNRROPBXVPFED-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2O |
|---|---|
| Molecular weight | 259.13 g/mol |
| IUPAC name | N-cyclopropyl-2-(3,5-dichloroanilino)acetamide |
| InChIKey | OHNRROPBXVPFED-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)CNC2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)