Products 1951425-24-3
CAS 1951425-24-3 appears in our catalog under these names: (R)-3-Amino-1-(2,4-dichlorobenzyl) pyrrolidin-2-one, 95%, (R)-3-Amino-1-(2,4-dichlorobenzyl)pyrrolidin-2-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
(3R)-3-amino-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-2-one (CAS 1951425-24-3) is a chemical compound with the molecular formula C11H12Cl2N2O and a molecular weight of 259.13 g/mol. IUPAC name: (3R)-3-amino-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-2-one. InChIKey: WTSGVPRAOMQIAR-SNVBAGLBSA-N.
| Molecular formula | C11H12Cl2N2O |
|---|---|
| Molecular weight | 259.13 g/mol |
| IUPAC name | (3R)-3-amino-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-2-one |
| InChIKey | WTSGVPRAOMQIAR-SNVBAGLBSA-N |
| SMILES | C1CN(C(=O)[C@@H]1N)CC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)